C27H26FN5O4S — CID 126612694
1-N'-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 126612694) has the molecular formula C27H26FN5O4S and a molecular weight of 535.60 g/mol. Its IUPAC name is 1-N'-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 126612694 |
| Molecular Formula | C27H26FN5O4S |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.17 |
| IUPAC Name | 1-N'-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | COCCNCc1ccc(-c2cc3nccc(Oc4ccc(NC(=O)C5(C(N)=O)CC5)cc4F)c3s2)nc1 |
| InChI | InChI=1S/C27H26FN5O4S/c1-36-11-10-30-14-16-2-4-19(32-15-16)23-13-20-24(38-23)22(6-9-31-20)37-21-5-3-17(12-18(21)28)33-26(35)27(7-8-27)25(29)34/h2-6,9,12-13,15,30H,7-8,10-11,14H2,1H3,(H2,29,34)(H,33,35) |
| InChIKey | UPEZUWYICPAWOC-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|