C33H32FN5O3S2 — CID 89202360
2-(2-ethylphenyl)-N-[[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]acetamide (PubChem CID 89202360) has the molecular formula C33H32FN5O3S2 and a molecular weight of 629.78 g/mol. Its IUPAC name is 2-(2-ethylphenyl)-N-[[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]acetamide.
| Compound Name | 2-(2-ethylphenyl)-N-[[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 89202360 |
| Molecular Formula | C33H32FN5O3S2 |
| Molecular Weight | 629.78 g/mol |
| Exact Mass | 629.19 |
| IUPAC Name | 2-(2-ethylphenyl)-N-[[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]acetamide |
| SMILES | CCc1ccccc1CC(=O)NC(=S)Nc1ccc(Oc2ccnc3cc(-c4ccc(CNCCOC)cn4)sc23)c(F)c1 |
| InChI | InChI=1S/C33H32FN5O3S2/c1-3-22-6-4-5-7-23(22)16-31(40)39-33(43)38-24-9-11-28(25(34)17-24)42-29-12-13-36-27-18-30(44-32(27)29)26-10-8-21(20-37-26)19-35-14-15-41-2/h4-13,17-18,20,35H,3,14-16,19H2,1-2H3,(H2,38,39,40,43) |
| InChIKey | CSZQKUITKQHGEX-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.78 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|