C32H30FN5O4S2 — CID 25269561
2-(4-fluorophenyl)-N-[[2-methoxy-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]acetamide (PubChem CID 25269561) has the molecular formula C32H30FN5O4S2 and a molecular weight of 631.76 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[[2-methoxy-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]acetamide.
| Compound Name | 2-(4-fluorophenyl)-N-[[2-methoxy-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 25269561 |
| Molecular Formula | C32H30FN5O4S2 |
| Molecular Weight | 631.76 g/mol |
| Exact Mass | 631.17 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[[2-methoxy-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]acetamide |
| SMILES | COCCNCc1ccc(-c2cc3nccc(Oc4ccc(NC(=S)NC(=O)Cc5ccc(F)cc5)c(OC)c4)c3s2)nc1 |
| InChI | InChI=1S/C32H30FN5O4S2/c1-40-14-13-34-18-21-5-9-25(36-19-21)29-17-26-31(44-29)27(11-12-35-26)42-23-8-10-24(28(16-23)41-2)37-32(43)38-30(39)15-20-3-6-22(33)7-4-20/h3-12,16-17,19,34H,13-15,18H2,1-2H3,(H2,37,38,39,43) |
| InChIKey | WCFYPKFEQSXMNG-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 106.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.76 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|