C21H19FN4O3S — CID 59011630
N-[[4-[(2-amino-4-pyridinyl)oxy]-2-methoxyphenyl]carbamothioyl]-2-(4-fluorophenyl)acetamide (PubChem CID 59011630) has the molecular formula C21H19FN4O3S and a molecular weight of 426.47 g/mol. Its IUPAC name is N-[[4-[(2-amino-4-pyridinyl)oxy]-2-methoxyphenyl]carbamothioyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[[4-[(2-amino-4-pyridinyl)oxy]-2-methoxyphenyl]carbamothioyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 59011630 |
| Molecular Formula | C21H19FN4O3S |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | N-[[4-[(2-amino-4-pyridinyl)oxy]-2-methoxyphenyl]carbamothioyl]-2-(4-fluorophenyl)acetamide |
| SMILES | COc1cc(Oc2ccnc(N)c2)ccc1NC(=S)NC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H19FN4O3S/c1-28-18-11-15(29-16-8-9-24-19(23)12-16)6-7-17(18)25-21(30)26-20(27)10-13-2-4-14(22)5-3-13/h2-9,11-12H,10H2,1H3,(H2,23,24)(H2,25,26,27,30) |
| InChIKey | IAKNXHONWHVFEC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|