C21H20N4O2S — CID 87654266
N-[[4-[(2-amino-4-pyridinyl)oxy]-2-methylphenyl]carbamothioyl]-2-phenylacetamide (PubChem CID 87654266) has the molecular formula C21H20N4O2S and a molecular weight of 392.48 g/mol. Its IUPAC name is N-[[4-[(2-amino-4-pyridinyl)oxy]-2-methylphenyl]carbamothioyl]-2-phenylacetamide.
| Compound Name | N-[[4-[(2-amino-4-pyridinyl)oxy]-2-methylphenyl]carbamothioyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 87654266 |
| Molecular Formula | C21H20N4O2S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-[[4-[(2-amino-4-pyridinyl)oxy]-2-methylphenyl]carbamothioyl]-2-phenylacetamide |
| SMILES | Cc1cc(Oc2ccnc(N)c2)ccc1NC(=S)NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C21H20N4O2S/c1-14-11-16(27-17-9-10-23-19(22)13-17)7-8-18(14)24-21(28)25-20(26)12-15-5-3-2-4-6-15/h2-11,13H,12H2,1H3,(H2,22,23)(H2,24,25,26,28) |
| InChIKey | ROUMQTPEKLCVCS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|