C19H16FN3O3 — CID 91573991
[4-[(2-amino-4-pyridinyl)oxy]-2-fluorophenyl] N-benzylcarbamate (PubChem CID 91573991) has the molecular formula C19H16FN3O3 and a molecular weight of 353.35 g/mol. Its IUPAC name is [4-[(2-amino-4-pyridinyl)oxy]-2-fluorophenyl] N-benzylcarbamate.
| Compound Name | [4-[(2-amino-4-pyridinyl)oxy]-2-fluorophenyl] N-benzylcarbamate |
|---|---|
| PubChem CID | 91573991 |
| Molecular Formula | C19H16FN3O3 |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | [4-[(2-amino-4-pyridinyl)oxy]-2-fluorophenyl] N-benzylcarbamate |
| SMILES | Nc1cc(Oc2ccc(OC(=O)NCc3ccccc3)c(F)c2)ccn1 |
| InChI | InChI=1S/C19H16FN3O3/c20-16-10-14(25-15-8-9-22-18(21)11-15)6-7-17(16)26-19(24)23-12-13-4-2-1-3-5-13/h1-11H,12H2,(H2,21,22)(H,23,24) |
| InChIKey | YBMWVNJVGPGXCW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |