C20H17ClN4O2S — CID 87651828
N-[[4-[(2-amino-4-pyridinyl)oxy]-2-chlorophenyl]carbamothioyl]-2-phenylacetamide (PubChem CID 87651828) has the molecular formula C20H17ClN4O2S and a molecular weight of 412.90 g/mol. Its IUPAC name is N-[[4-[(2-amino-4-pyridinyl)oxy]-2-chlorophenyl]carbamothioyl]-2-phenylacetamide.
| Compound Name | N-[[4-[(2-amino-4-pyridinyl)oxy]-2-chlorophenyl]carbamothioyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 87651828 |
| Molecular Formula | C20H17ClN4O2S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | N-[[4-[(2-amino-4-pyridinyl)oxy]-2-chlorophenyl]carbamothioyl]-2-phenylacetamide |
| SMILES | Nc1cc(Oc2ccc(NC(=S)NC(=O)Cc3ccccc3)c(Cl)c2)ccn1 |
| InChI | InChI=1S/C20H17ClN4O2S/c21-16-11-14(27-15-8-9-23-18(22)12-15)6-7-17(16)24-20(28)25-19(26)10-13-4-2-1-3-5-13/h1-9,11-12H,10H2,(H2,22,23)(H2,24,25,26,28) |
| InChIKey | VMJNMGRPZXIWPJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|