C22H21F2N5O3 — CID 66917607
2-(2-amino-1-phenylethyl)-N'-[4-[(2-amino-4-pyridinyl)oxy]-2,5-difluorophenyl]propanediamide (PubChem CID 66917607) has the molecular formula C22H21F2N5O3 and a molecular weight of 441.44 g/mol. Its IUPAC name is 2-(2-amino-1-phenylethyl)-N'-[4-[(2-amino-4-pyridinyl)oxy]-2,5-difluorophenyl]propanediamide.
| Compound Name | 2-(2-amino-1-phenylethyl)-N'-[4-[(2-amino-4-pyridinyl)oxy]-2,5-difluorophenyl]propanediamide |
|---|---|
| PubChem CID | 66917607 |
| Molecular Formula | C22H21F2N5O3 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 2-(2-amino-1-phenylethyl)-N'-[4-[(2-amino-4-pyridinyl)oxy]-2,5-difluorophenyl]propanediamide |
| SMILES | NCC(c1ccccc1)C(C(N)=O)C(=O)Nc1cc(F)c(Oc2ccnc(N)c2)cc1F |
| InChI | InChI=1S/C22H21F2N5O3/c23-15-10-18(32-13-6-7-28-19(26)8-13)16(24)9-17(15)29-22(31)20(21(27)30)14(11-25)12-4-2-1-3-5-12/h1-10,14,20H,11,25H2,(H2,26,28)(H2,27,30)(H,29,31) |
| InChIKey | RTEDNNLCIITAJD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 146.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|