C22H19FN4O3S — CID 87651103
4-[4-[[2-(4-fluorophenyl)acetyl]carbamothioylamino]-2-methylphenoxy]pyridine-2-carboxamide (PubChem CID 87651103) has the molecular formula C22H19FN4O3S and a molecular weight of 438.48 g/mol. Its IUPAC name is 4-[4-[[2-(4-fluorophenyl)acetyl]carbamothioylamino]-2-methylphenoxy]pyridine-2-carboxamide.
| Compound Name | 4-[4-[[2-(4-fluorophenyl)acetyl]carbamothioylamino]-2-methylphenoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 87651103 |
| Molecular Formula | C22H19FN4O3S |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 4-[4-[[2-(4-fluorophenyl)acetyl]carbamothioylamino]-2-methylphenoxy]pyridine-2-carboxamide |
| SMILES | Cc1cc(NC(=S)NC(=O)Cc2ccc(F)cc2)ccc1Oc1ccnc(C(N)=O)c1 |
| InChI | InChI=1S/C22H19FN4O3S/c1-13-10-16(6-7-19(13)30-17-8-9-25-18(12-17)21(24)29)26-22(31)27-20(28)11-14-2-4-15(23)5-3-14/h2-10,12H,11H2,1H3,(H2,24,29)(H2,26,27,28,31) |
| InChIKey | GXCXAWWTMNRWQC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|