C22H18FN5OS — CID 11597707
N-[[4-(4-aminopyrrolo[3,2-c]pyridin-1-yl)phenyl]carbamothioyl]-2-(4-fluorophenyl)acetamide (PubChem CID 11597707) has the molecular formula C22H18FN5OS and a molecular weight of 419.49 g/mol. Its IUPAC name is N-[[4-(4-aminopyrrolo[3,2-c]pyridin-1-yl)phenyl]carbamothioyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[[4-(4-aminopyrrolo[3,2-c]pyridin-1-yl)phenyl]carbamothioyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 11597707 |
| Molecular Formula | C22H18FN5OS |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | N-[[4-(4-aminopyrrolo[3,2-c]pyridin-1-yl)phenyl]carbamothioyl]-2-(4-fluorophenyl)acetamide |
| SMILES | Nc1nccc2c1ccn2-c1ccc(NC(=S)NC(=O)Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H18FN5OS/c23-15-3-1-14(2-4-15)13-20(29)27-22(30)26-16-5-7-17(8-6-16)28-12-10-18-19(28)9-11-25-21(18)24/h1-12H,13H2,(H2,24,25)(H2,26,27,29,30) |
| InChIKey | CBHHTLYITPTHCW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|