C22H19FN2O4 — CID 175641008
methyl 2-[4-[[1-(4-fluorophenyl)-4-methyl-2-oxopyridine-3-carbonyl]amino]phenyl]acetate (PubChem CID 175641008) has the molecular formula C22H19FN2O4 and a molecular weight of 394.40 g/mol. Its IUPAC name is methyl 2-[4-[[1-(4-fluorophenyl)-4-methyl-2-oxopyridine-3-carbonyl]amino]phenyl]acetate.
| Compound Name | methyl 2-[4-[[1-(4-fluorophenyl)-4-methyl-2-oxopyridine-3-carbonyl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 175641008 |
| Molecular Formula | C22H19FN2O4 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | methyl 2-[4-[[1-(4-fluorophenyl)-4-methyl-2-oxopyridine-3-carbonyl]amino]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(NC(=O)c2c(C)ccn(-c3ccc(F)cc3)c2=O)cc1 |
| InChI | InChI=1S/C22H19FN2O4/c1-14-11-12-25(18-9-5-16(23)6-10-18)22(28)20(14)21(27)24-17-7-3-15(4-8-17)13-19(26)29-2/h3-12H,13H2,1-2H3,(H,24,27) |
| InChIKey | YSAIDBNSHDGTLF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |