C22H16F2N4O2S2 — CID 11684236
N-[[3-fluoro-4-(7-methylthieno[3,2-d]pyrimidin-4-yl)oxyphenyl]carbamothioyl]-2-(4-fluorophenyl)acetamide (PubChem CID 11684236) has the molecular formula C22H16F2N4O2S2 and a molecular weight of 470.53 g/mol. Its IUPAC name is N-[[3-fluoro-4-(7-methylthieno[3,2-d]pyrimidin-4-yl)oxyphenyl]carbamothioyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[[3-fluoro-4-(7-methylthieno[3,2-d]pyrimidin-4-yl)oxyphenyl]carbamothioyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 11684236 |
| Molecular Formula | C22H16F2N4O2S2 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | N-[[3-fluoro-4-(7-methylthieno[3,2-d]pyrimidin-4-yl)oxyphenyl]carbamothioyl]-2-(4-fluorophenyl)acetamide |
| SMILES | Cc1csc2c(Oc3ccc(NC(=S)NC(=O)Cc4ccc(F)cc4)cc3F)ncnc12 |
| InChI | InChI=1S/C22H16F2N4O2S2/c1-12-10-32-20-19(12)25-11-26-21(20)30-17-7-6-15(9-16(17)24)27-22(31)28-18(29)8-13-2-4-14(23)5-3-13/h2-7,9-11H,8H2,1H3,(H2,27,28,29,31) |
| InChIKey | VYPPIUIWIABGBQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|