C33H35FN5O5PS — CID 58236611
1-(3-dimethylphosphorylphenyl)-3-[3-fluoro-4-[2-[5-[[2-(2-methoxyethoxy)ethylamino]methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]urea (PubChem CID 58236611) has the molecular formula C33H35FN5O5PS and a molecular weight of 663.71 g/mol. Its IUPAC name is 1-(3-dimethylphosphorylphenyl)-3-[3-fluoro-4-[2-[5-[[2-(2-methoxyethoxy)ethylamino]methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]urea.
| Compound Name | 1-(3-dimethylphosphorylphenyl)-3-[3-fluoro-4-[2-[5-[[2-(2-methoxyethoxy)ethylamino]methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]urea |
|---|---|
| PubChem CID | 58236611 |
| Molecular Formula | C33H35FN5O5PS |
| Molecular Weight | 663.71 g/mol |
| Exact Mass | 663.21 |
| IUPAC Name | 1-(3-dimethylphosphorylphenyl)-3-[3-fluoro-4-[2-[5-[[2-(2-methoxyethoxy)ethylamino]methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]urea |
| SMILES | COCCOCCNCc1ccc(-c2cc3nccc(Oc4ccc(NC(=O)Nc5cccc(P(C)(C)=O)c5)cc4F)c3s2)nc1 |
| InChI | InChI=1S/C33H35FN5O5PS/c1-42-15-16-43-14-13-35-20-22-7-9-27(37-21-22)31-19-28-32(46-31)30(11-12-36-28)44-29-10-8-24(18-26(29)34)39-33(40)38-23-5-4-6-25(17-23)45(2,3)41/h4-12,17-19,21,35H,13-16,20H2,1-3H3,(H2,38,39,40) |
| InChIKey | FCZASDYROXGJDK-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 123.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.71 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|