C17H13FN4OS — CID 59424431
3-fluoro-4-[2-(3-methylimidazol-4-yl)thieno[3,2-b]pyridin-7-yl]oxyaniline (PubChem CID 59424431) has the molecular formula C17H13FN4OS and a molecular weight of 340.38 g/mol. Its IUPAC name is 3-fluoro-4-[2-(3-methylimidazol-4-yl)thieno[3,2-b]pyridin-7-yl]oxyaniline.
| Compound Name | 3-fluoro-4-[2-(3-methylimidazol-4-yl)thieno[3,2-b]pyridin-7-yl]oxyaniline |
|---|---|
| PubChem CID | 59424431 |
| Molecular Formula | C17H13FN4OS |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 3-fluoro-4-[2-(3-methylimidazol-4-yl)thieno[3,2-b]pyridin-7-yl]oxyaniline |
| SMILES | Cn1cncc1-c1cc2nccc(Oc3ccc(N)cc3F)c2s1 |
| InChI | InChI=1S/C17H13FN4OS/c1-22-9-20-8-13(22)16-7-12-17(24-16)15(4-5-21-12)23-14-3-2-10(19)6-11(14)18/h2-9H,19H2,1H3 |
| InChIKey | RDZMWVMJZRXGSF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|