C14H12FN3O4S2 — CID 89360799
7-(4-amino-2-fluorophenoxy)-N-methoxythieno[3,2-b]pyridine-2-sulfonamide (PubChem CID 89360799) has the molecular formula C14H12FN3O4S2 and a molecular weight of 369.40 g/mol. Its IUPAC name is 7-(4-amino-2-fluorophenoxy)-N-methoxythieno[3,2-b]pyridine-2-sulfonamide.
| Compound Name | 7-(4-amino-2-fluorophenoxy)-N-methoxythieno[3,2-b]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 89360799 |
| Molecular Formula | C14H12FN3O4S2 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | 7-(4-amino-2-fluorophenoxy)-N-methoxythieno[3,2-b]pyridine-2-sulfonamide |
| SMILES | CONS(=O)(=O)c1cc2nccc(Oc3ccc(N)cc3F)c2s1 |
| InChI | InChI=1S/C14H12FN3O4S2/c1-21-18-24(19,20)13-7-10-14(23-13)12(4-5-17-10)22-11-3-2-8(16)6-9(11)15/h2-7,18H,16H2,1H3 |
| InChIKey | QJARVWFLUHLZFE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|