C19H15FN4O3S — CID 59424445
methyl 2-[7-(4-amino-2-fluorophenoxy)thieno[3,2-b]pyridin-2-yl]-3-methylimidazole-4-carboxylate (PubChem CID 59424445) has the molecular formula C19H15FN4O3S and a molecular weight of 398.42 g/mol. Its IUPAC name is methyl 2-[7-(4-amino-2-fluorophenoxy)thieno[3,2-b]pyridin-2-yl]-3-methylimidazole-4-carboxylate.
| Compound Name | methyl 2-[7-(4-amino-2-fluorophenoxy)thieno[3,2-b]pyridin-2-yl]-3-methylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 59424445 |
| Molecular Formula | C19H15FN4O3S |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | methyl 2-[7-(4-amino-2-fluorophenoxy)thieno[3,2-b]pyridin-2-yl]-3-methylimidazole-4-carboxylate |
| SMILES | COC(=O)c1cnc(-c2cc3nccc(Oc4ccc(N)cc4F)c3s2)n1C |
| InChI | InChI=1S/C19H15FN4O3S/c1-24-13(19(25)26-2)9-23-18(24)16-8-12-17(28-16)15(5-6-22-12)27-14-4-3-10(21)7-11(14)20/h3-9H,21H2,1-2H3 |
| InChIKey | PMVKCAUDIPNDKD-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|