C20H16FN3O2S — CID 59457737
7-(4-amino-2-fluorophenoxy)-N-(3-methoxyphenyl)thieno[3,2-b]pyridin-2-amine (PubChem CID 59457737) has the molecular formula C20H16FN3O2S and a molecular weight of 381.43 g/mol. Its IUPAC name is 7-(4-amino-2-fluorophenoxy)-N-(3-methoxyphenyl)thieno[3,2-b]pyridin-2-amine.
| Compound Name | 7-(4-amino-2-fluorophenoxy)-N-(3-methoxyphenyl)thieno[3,2-b]pyridin-2-amine |
|---|---|
| PubChem CID | 59457737 |
| Molecular Formula | C20H16FN3O2S |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 7-(4-amino-2-fluorophenoxy)-N-(3-methoxyphenyl)thieno[3,2-b]pyridin-2-amine |
| SMILES | COc1cccc(Nc2cc3nccc(Oc4ccc(N)cc4F)c3s2)c1 |
| InChI | InChI=1S/C20H16FN3O2S/c1-25-14-4-2-3-13(10-14)24-19-11-16-20(27-19)18(7-8-23-16)26-17-6-5-12(22)9-15(17)21/h2-11,24H,22H2,1H3 |
| InChIKey | DQRXNPIGWYMKBX-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|