C21H22FN3OS — CID 67348637
4-[2-[4-(diethylamino)but-1-ynyl]thieno[3,2-b]pyridin-7-yl]oxy-3-fluoroaniline (PubChem CID 67348637) has the molecular formula C21H22FN3OS and a molecular weight of 383.49 g/mol. Its IUPAC name is 4-[2-[4-(diethylamino)but-1-ynyl]thieno[3,2-b]pyridin-7-yl]oxy-3-fluoroaniline.
| Compound Name | 4-[2-[4-(diethylamino)but-1-ynyl]thieno[3,2-b]pyridin-7-yl]oxy-3-fluoroaniline |
|---|---|
| PubChem CID | 67348637 |
| Molecular Formula | C21H22FN3OS |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 4-[2-[4-(diethylamino)but-1-ynyl]thieno[3,2-b]pyridin-7-yl]oxy-3-fluoroaniline |
| SMILES | CCN(CC)CCC#Cc1cc2nccc(Oc3ccc(N)cc3F)c2s1 |
| InChI | InChI=1S/C21H22FN3OS/c1-3-25(4-2)12-6-5-7-16-14-18-21(27-16)20(10-11-24-18)26-19-9-8-15(23)13-17(19)22/h8-11,13-14H,3-4,6,12,23H2,1-2H3 |
| InChIKey | BUQZYAOPJGKAKV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|