C19H25FN6O4 — CID 23153258
1-[3-(diethylamino)propyl]-3-[6-(2-fluoro-4-nitrophenoxy)pyrimidin-4-yl]-1-methylurea (PubChem CID 23153258) has the molecular formula C19H25FN6O4 and a molecular weight of 420.45 g/mol. Its IUPAC name is 1-[3-(diethylamino)propyl]-3-[6-(2-fluoro-4-nitrophenoxy)pyrimidin-4-yl]-1-methylurea.
| Compound Name | 1-[3-(diethylamino)propyl]-3-[6-(2-fluoro-4-nitrophenoxy)pyrimidin-4-yl]-1-methylurea |
|---|---|
| PubChem CID | 23153258 |
| Molecular Formula | C19H25FN6O4 |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 1-[3-(diethylamino)propyl]-3-[6-(2-fluoro-4-nitrophenoxy)pyrimidin-4-yl]-1-methylurea |
| SMILES | CCN(CC)CCCN(C)C(=O)Nc1cc(Oc2ccc([N+](=O)[O-])cc2F)ncn1 |
| InChI | InChI=1S/C19H25FN6O4/c1-4-25(5-2)10-6-9-24(3)19(27)23-17-12-18(22-13-21-17)30-16-8-7-14(26(28)29)11-15(16)20/h7-8,11-13H,4-6,9-10H2,1-3H3,(H,21,22,23,27) |
| InChIKey | IKBQVYBYMHBVBC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|