C21H30FN7O2 — CID 23153028
3-[6-(4-amino-2-fluorophenoxy)pyrimidin-4-yl]-1-[1-[2-(dimethylamino)ethyl]piperidin-4-yl]-1-methylurea (PubChem CID 23153028) has the molecular formula C21H30FN7O2 and a molecular weight of 431.52 g/mol. Its IUPAC name is 3-[6-(4-amino-2-fluorophenoxy)pyrimidin-4-yl]-1-[1-[2-(dimethylamino)ethyl]piperidin-4-yl]-1-methylurea.
| Compound Name | 3-[6-(4-amino-2-fluorophenoxy)pyrimidin-4-yl]-1-[1-[2-(dimethylamino)ethyl]piperidin-4-yl]-1-methylurea |
|---|---|
| PubChem CID | 23153028 |
| Molecular Formula | C21H30FN7O2 |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 3-[6-(4-amino-2-fluorophenoxy)pyrimidin-4-yl]-1-[1-[2-(dimethylamino)ethyl]piperidin-4-yl]-1-methylurea |
| SMILES | CN(C)CCN1CCC(N(C)C(=O)Nc2cc(Oc3ccc(N)cc3F)ncn2)CC1 |
| InChI | InChI=1S/C21H30FN7O2/c1-27(2)10-11-29-8-6-16(7-9-29)28(3)21(30)26-19-13-20(25-14-24-19)31-18-5-4-15(23)12-17(18)22/h4-5,12-14,16H,6-11,23H2,1-3H3,(H,24,25,26,30) |
| InChIKey | RMEHPFMPQMNQFH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|