C23H31FN6O4 — CID 23153320
1-[1-[3-(dimethylamino)propyl]piperidin-4-yl]-3-[4-(2-fluoro-4-nitrophenoxy)-2-pyridinyl]-1-methylurea (PubChem CID 23153320) has the molecular formula C23H31FN6O4 and a molecular weight of 474.54 g/mol. Its IUPAC name is 1-[1-[3-(dimethylamino)propyl]piperidin-4-yl]-3-[4-(2-fluoro-4-nitrophenoxy)-2-pyridinyl]-1-methylurea.
| Compound Name | 1-[1-[3-(dimethylamino)propyl]piperidin-4-yl]-3-[4-(2-fluoro-4-nitrophenoxy)-2-pyridinyl]-1-methylurea |
|---|---|
| PubChem CID | 23153320 |
| Molecular Formula | C23H31FN6O4 |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | 1-[1-[3-(dimethylamino)propyl]piperidin-4-yl]-3-[4-(2-fluoro-4-nitrophenoxy)-2-pyridinyl]-1-methylurea |
| SMILES | CN(C)CCCN1CCC(N(C)C(=O)Nc2cc(Oc3ccc([N+](=O)[O-])cc3F)ccn2)CC1 |
| InChI | InChI=1S/C23H31FN6O4/c1-27(2)11-4-12-29-13-8-17(9-14-29)28(3)23(31)26-22-16-19(7-10-25-22)34-21-6-5-18(30(32)33)15-20(21)24/h5-7,10,15-17H,4,8-9,11-14H2,1-3H3,(H,25,26,31) |
| InChIKey | JTQOTFOQYVOIPX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|