C14H15FN4O2 — CID 23153283
3-[4-(4-amino-2-fluorophenoxy)-2-pyridinyl]-1,1-dimethylurea (PubChem CID 23153283) has the molecular formula C14H15FN4O2 and a molecular weight of 290.30 g/mol. Its IUPAC name is 3-[4-(4-amino-2-fluorophenoxy)-2-pyridinyl]-1,1-dimethylurea.
| Compound Name | 3-[4-(4-amino-2-fluorophenoxy)-2-pyridinyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 23153283 |
| Molecular Formula | C14H15FN4O2 |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 3-[4-(4-amino-2-fluorophenoxy)-2-pyridinyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1cc(Oc2ccc(N)cc2F)ccn1 |
| InChI | InChI=1S/C14H15FN4O2/c1-19(2)14(20)18-13-8-10(5-6-17-13)21-12-4-3-9(16)7-11(12)15/h3-8H,16H2,1-2H3,(H,17,18,20) |
| InChIKey | VCIBHJOWEQAWAY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|