C22H27FN6O3S — CID 87651816
N-[[3-fluoro-4-[[2-[[methyl-(1-methylpiperidin-4-yl)carbamoyl]amino]-4-pyridinyl]oxy]phenyl]carbamothioyl]acetamide (PubChem CID 87651816) has the molecular formula C22H27FN6O3S and a molecular weight of 474.56 g/mol. Its IUPAC name is N-[[3-fluoro-4-[[2-[[methyl-(1-methylpiperidin-4-yl)carbamoyl]amino]-4-pyridinyl]oxy]phenyl]carbamothioyl]acetamide.
| Compound Name | N-[[3-fluoro-4-[[2-[[methyl-(1-methylpiperidin-4-yl)carbamoyl]amino]-4-pyridinyl]oxy]phenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 87651816 |
| Molecular Formula | C22H27FN6O3S |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | N-[[3-fluoro-4-[[2-[[methyl-(1-methylpiperidin-4-yl)carbamoyl]amino]-4-pyridinyl]oxy]phenyl]carbamothioyl]acetamide |
| SMILES | CC(=O)NC(=S)Nc1ccc(Oc2ccnc(NC(=O)N(C)C3CCN(C)CC3)c2)c(F)c1 |
| InChI | InChI=1S/C22H27FN6O3S/c1-14(30)25-21(33)26-15-4-5-19(18(23)12-15)32-17-6-9-24-20(13-17)27-22(31)29(3)16-7-10-28(2)11-8-16/h4-6,9,12-13,16H,7-8,10-11H2,1-3H3,(H,24,27,31)(H2,25,26,30,33) |
| InChIKey | NVKMCJOZYRESBJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|