C22H27FN6O4 — CID 23153163
N-[4-(2-fluoro-4-nitrophenoxy)-2-pyridinyl]-4-(1-methylpiperidin-4-yl)piperazine-1-carboxamide (PubChem CID 23153163) has the molecular formula C22H27FN6O4 and a molecular weight of 458.49 g/mol. Its IUPAC name is N-[4-(2-fluoro-4-nitrophenoxy)-2-pyridinyl]-4-(1-methylpiperidin-4-yl)piperazine-1-carboxamide.
| Compound Name | N-[4-(2-fluoro-4-nitrophenoxy)-2-pyridinyl]-4-(1-methylpiperidin-4-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 23153163 |
| Molecular Formula | C22H27FN6O4 |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | N-[4-(2-fluoro-4-nitrophenoxy)-2-pyridinyl]-4-(1-methylpiperidin-4-yl)piperazine-1-carboxamide |
| SMILES | CN1CCC(N2CCN(C(=O)Nc3cc(Oc4ccc([N+](=O)[O-])cc4F)ccn3)CC2)CC1 |
| InChI | InChI=1S/C22H27FN6O4/c1-26-8-5-16(6-9-26)27-10-12-28(13-11-27)22(30)25-21-15-18(4-7-24-21)33-20-3-2-17(29(31)32)14-19(20)23/h2-4,7,14-16H,5-6,8-13H2,1H3,(H,24,25,30) |
| InChIKey | PLKUYBPQOPHWRJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|