C22H28FN5O2 — CID 141315174
N-[4-(3-fluorophenoxy)-2-pyridinyl]-4-(4-methylpiperazin-1-yl)piperidine-1-carboxamide (PubChem CID 141315174) has the molecular formula C22H28FN5O2 and a molecular weight of 413.50 g/mol. Its IUPAC name is N-[4-(3-fluorophenoxy)-2-pyridinyl]-4-(4-methylpiperazin-1-yl)piperidine-1-carboxamide.
| Compound Name | N-[4-(3-fluorophenoxy)-2-pyridinyl]-4-(4-methylpiperazin-1-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 141315174 |
| Molecular Formula | C22H28FN5O2 |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | N-[4-(3-fluorophenoxy)-2-pyridinyl]-4-(4-methylpiperazin-1-yl)piperidine-1-carboxamide |
| SMILES | CN1CCN(C2CCN(C(=O)Nc3cc(Oc4cccc(F)c4)ccn3)CC2)CC1 |
| InChI | InChI=1S/C22H28FN5O2/c1-26-11-13-27(14-12-26)18-6-9-28(10-7-18)22(29)25-21-16-20(5-8-24-21)30-19-4-2-3-17(23)15-19/h2-5,8,15-16,18H,6-7,9-14H2,1H3,(H,24,25,29) |
| InChIKey | CJIGAGIKWJMBCA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |