C17H17FN6O4 — CID 91301177
(1S,4S)-N-[6-(2-fluoro-4-nitrophenoxy)pyrimidin-4-yl]-5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 91301177) has the molecular formula C17H17FN6O4 and a molecular weight of 388.36 g/mol. Its IUPAC name is (1S,4S)-N-[6-(2-fluoro-4-nitrophenoxy)pyrimidin-4-yl]-5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,4S)-N-[6-(2-fluoro-4-nitrophenoxy)pyrimidin-4-yl]-5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 91301177 |
| Molecular Formula | C17H17FN6O4 |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | (1S,4S)-N-[6-(2-fluoro-4-nitrophenoxy)pyrimidin-4-yl]-5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CN1C[C@@H]2C[C@H]1CN2C(=O)Nc1cc(Oc2ccc([N+](=O)[O-])cc2F)ncn1 |
| InChI | InChI=1S/C17H17FN6O4/c1-22-7-12-4-11(22)8-23(12)17(25)21-15-6-16(20-9-19-15)28-14-3-2-10(24(26)27)5-13(14)18/h2-3,5-6,9,11-12H,4,7-8H2,1H3,(H,19,20,21,25)/t11-,12-/m0/s1 |
| InChIKey | HMRUIMWYPJPEAZ-RYUDHWBXSA-N |
| XLogP | 2.24 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|