C24H27FN6O8 — CID 175248426
1-[6-(2-fluoro-4-nitrophenoxy)pyrimidin-4-yl]-3-methylcyclohex-4-ene-1,3-dicarboxylic acid;(1-methylazetidin-3-yl)urea (PubChem CID 175248426) has the molecular formula C24H27FN6O8 and a molecular weight of 546.51 g/mol. Its IUPAC name is 1-[6-(2-fluoro-4-nitrophenoxy)pyrimidin-4-yl]-3-methylcyclohex-4-ene-1,3-dicarboxylic acid;(1-methylazetidin-3-yl)urea.
| Compound Name | 1-[6-(2-fluoro-4-nitrophenoxy)pyrimidin-4-yl]-3-methylcyclohex-4-ene-1,3-dicarboxylic acid;(1-methylazetidin-3-yl)urea |
|---|---|
| PubChem CID | 175248426 |
| Molecular Formula | C24H27FN6O8 |
| Molecular Weight | 546.51 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | 1-[6-(2-fluoro-4-nitrophenoxy)pyrimidin-4-yl]-3-methylcyclohex-4-ene-1,3-dicarboxylic acid;(1-methylazetidin-3-yl)urea |
| SMILES | CC1(C(=O)O)C=CCC(C(=O)O)(c2cc(Oc3ccc([N+](=O)[O-])cc3F)ncn2)C1.CN1CC(NC(N)=O)C1 |
| InChI | InChI=1S/C19H16FN3O7.C5H11N3O/c1-18(16(24)25)5-2-6-19(9-18,17(26)27)14-8-15(22-10-21-14)30-13-4-3-11(23(28)29)7-12(13)20;1-8-2-4(3-8)7-5(6)9/h2-5,7-8,10H,6,9H2,1H3,(H,24,25)(H,26,27);4H,2-3H2,1H3,(H3,6,7,9) |
| InChIKey | CKCAJBOYOKPEFV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 211.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.51 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|