C22H30N6O4 — CID 174500763
1-[1-(2-amino-2-methylpropyl)piperidin-4-yl]-1-methyl-3-[4-(4-nitrophenoxy)-2-pyridinyl]urea (PubChem CID 174500763) has the molecular formula C22H30N6O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 1-[1-(2-amino-2-methylpropyl)piperidin-4-yl]-1-methyl-3-[4-(4-nitrophenoxy)-2-pyridinyl]urea.
| Compound Name | 1-[1-(2-amino-2-methylpropyl)piperidin-4-yl]-1-methyl-3-[4-(4-nitrophenoxy)-2-pyridinyl]urea |
|---|---|
| PubChem CID | 174500763 |
| Molecular Formula | C22H30N6O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 1-[1-(2-amino-2-methylpropyl)piperidin-4-yl]-1-methyl-3-[4-(4-nitrophenoxy)-2-pyridinyl]urea |
| SMILES | CN(C(=O)Nc1cc(Oc2ccc([N+](=O)[O-])cc2)ccn1)C1CCN(CC(C)(C)N)CC1 |
| InChI | InChI=1S/C22H30N6O4/c1-22(2,23)15-27-12-9-16(10-13-27)26(3)21(29)25-20-14-19(8-11-24-20)32-18-6-4-17(5-7-18)28(30)31/h4-8,11,14,16H,9-10,12-13,15,23H2,1-3H3,(H,24,25,29) |
| InChIKey | QUXMKQKCXXTQFG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 126.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|