C27H26N4O4 — CID 70843625
tert-butyl N-[3-[[6-(4-phenoxyphenoxy)pyrimidin-4-yl]amino]phenyl]carbamate (PubChem CID 70843625) has the molecular formula C27H26N4O4 and a molecular weight of 470.53 g/mol. Its IUPAC name is tert-butyl N-[3-[[6-(4-phenoxyphenoxy)pyrimidin-4-yl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[[6-(4-phenoxyphenoxy)pyrimidin-4-yl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 70843625 |
| Molecular Formula | C27H26N4O4 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | tert-butyl N-[3-[[6-(4-phenoxyphenoxy)pyrimidin-4-yl]amino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(Nc2cc(Oc3ccc(Oc4ccccc4)cc3)ncn2)c1 |
| InChI | InChI=1S/C27H26N4O4/c1-27(2,3)35-26(32)31-20-9-7-8-19(16-20)30-24-17-25(29-18-28-24)34-23-14-12-22(13-15-23)33-21-10-5-4-6-11-21/h4-18H,1-3H3,(H,31,32)(H,28,29,30) |
| InChIKey | JHGIGZUTYXIGST-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |