C40H35N9O5S — CID 158638793
6-(4-aminophenoxy)-N-phenylpyrimidin-4-amine;1-[4-(6-anilinopyrimidin-4-yl)oxyphenyl]-3-(3-methylsulfonylphenyl)urea (PubChem CID 158638793) has the molecular formula C40H35N9O5S and a molecular weight of 753.85 g/mol. Its IUPAC name is 6-(4-aminophenoxy)-N-phenylpyrimidin-4-amine;1-[4-(6-anilinopyrimidin-4-yl)oxyphenyl]-3-(3-methylsulfonylphenyl)urea.
| Compound Name | 6-(4-aminophenoxy)-N-phenylpyrimidin-4-amine;1-[4-(6-anilinopyrimidin-4-yl)oxyphenyl]-3-(3-methylsulfonylphenyl)urea |
|---|---|
| PubChem CID | 158638793 |
| Molecular Formula | C40H35N9O5S |
| Molecular Weight | 753.85 g/mol |
| Exact Mass | 753.25 |
| IUPAC Name | 6-(4-aminophenoxy)-N-phenylpyrimidin-4-amine;1-[4-(6-anilinopyrimidin-4-yl)oxyphenyl]-3-(3-methylsulfonylphenyl)urea |
| SMILES | CS(=O)(=O)c1cccc(NC(=O)Nc2ccc(Oc3cc(Nc4ccccc4)ncn3)cc2)c1.Nc1ccc(Oc2cc(Nc3ccccc3)ncn2)cc1 |
| InChI | InChI=1S/C24H21N5O4S.C16H14N4O/c1-34(31,32)21-9-5-8-19(14-21)29-24(30)28-18-10-12-20(13-11-18)33-23-15-22(25-16-26-23)27-17-6-3-2-4-7-17;17-12-6-8-14(9-7-12)21-16-10-15(18-11-19-16)20-13-4-2-1-3-5-13/h2-16H,1H3,(H,25,26,27)(H2,28,29,30);1-11H,17H2,(H,18,19,20) |
| InChIKey | IACNPVZUFQHHHK-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 195.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.85 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|