C27H25N9O3 — CID 160708117
4-(4-aminophenoxy)pyrimidin-2-amine;1-[4-(2-aminopyrimidin-4-yl)oxyphenyl]-3-phenylurea (PubChem CID 160708117) has the molecular formula C27H25N9O3 and a molecular weight of 523.56 g/mol. Its IUPAC name is 4-(4-aminophenoxy)pyrimidin-2-amine;1-[4-(2-aminopyrimidin-4-yl)oxyphenyl]-3-phenylurea.
| Compound Name | 4-(4-aminophenoxy)pyrimidin-2-amine;1-[4-(2-aminopyrimidin-4-yl)oxyphenyl]-3-phenylurea |
|---|---|
| PubChem CID | 160708117 |
| Molecular Formula | C27H25N9O3 |
| Molecular Weight | 523.56 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | 4-(4-aminophenoxy)pyrimidin-2-amine;1-[4-(2-aminopyrimidin-4-yl)oxyphenyl]-3-phenylurea |
| SMILES | Nc1ccc(Oc2ccnc(N)n2)cc1.Nc1nccc(Oc2ccc(NC(=O)Nc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C17H15N5O2.C10H10N4O/c18-16-19-11-10-15(22-16)24-14-8-6-13(7-9-14)21-17(23)20-12-4-2-1-3-5-12;11-7-1-3-8(4-2-7)15-9-5-6-13-10(12)14-9/h1-11H,(H2,18,19,22)(H2,20,21,23);1-6H,11H2,(H2,12,13,14) |
| InChIKey | RRMOBMCIKSBVAT-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 189.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.56 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|