C41H32FN5O3 — CID 158881866
1-(4-fluorophenyl)-3-[4-[(2-phenyl-4-pyridinyl)oxy]phenyl]urea;4-[(2-phenyl-4-pyridinyl)oxy]aniline (PubChem CID 158881866) has the molecular formula C41H32FN5O3 and a molecular weight of 661.74 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[4-[(2-phenyl-4-pyridinyl)oxy]phenyl]urea;4-[(2-phenyl-4-pyridinyl)oxy]aniline.
| Compound Name | 1-(4-fluorophenyl)-3-[4-[(2-phenyl-4-pyridinyl)oxy]phenyl]urea;4-[(2-phenyl-4-pyridinyl)oxy]aniline |
|---|---|
| PubChem CID | 158881866 |
| Molecular Formula | C41H32FN5O3 |
| Molecular Weight | 661.74 g/mol |
| Exact Mass | 661.25 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[4-[(2-phenyl-4-pyridinyl)oxy]phenyl]urea;4-[(2-phenyl-4-pyridinyl)oxy]aniline |
| SMILES | Nc1ccc(Oc2ccnc(-c3ccccc3)c2)cc1.O=C(Nc1ccc(F)cc1)Nc1ccc(Oc2ccnc(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C24H18FN3O2.C17H14N2O/c25-18-6-8-19(9-7-18)27-24(29)28-20-10-12-21(13-11-20)30-22-14-15-26-23(16-22)17-4-2-1-3-5-17;18-14-6-8-15(9-7-14)20-16-10-11-19-17(12-16)13-4-2-1-3-5-13/h1-16H,(H2,27,28,29);1-12H,18H2 |
| InChIKey | JDCYKNSQLZKANZ-UHFFFAOYSA-N |
| XLogP | 10.45 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.74 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|