C24H18FN3O2 — CID 22936728
1-(4-fluorophenyl)-3-[4-[(3-phenyl-4-pyridinyl)oxy]phenyl]urea (PubChem CID 22936728) has the molecular formula C24H18FN3O2 and a molecular weight of 399.43 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[4-[(3-phenyl-4-pyridinyl)oxy]phenyl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[4-[(3-phenyl-4-pyridinyl)oxy]phenyl]urea |
|---|---|
| PubChem CID | 22936728 |
| Molecular Formula | C24H18FN3O2 |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[4-[(3-phenyl-4-pyridinyl)oxy]phenyl]urea |
| SMILES | O=C(Nc1ccc(F)cc1)Nc1ccc(Oc2ccncc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H18FN3O2/c25-18-6-8-19(9-7-18)27-24(29)28-20-10-12-21(13-11-20)30-23-14-15-26-16-22(23)17-4-2-1-3-5-17/h1-16H,(H2,27,28,29) |
| InChIKey | YWBRABVTZXAHFI-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |