C26H22N2O3 — CID 129142524
N-[[3-[4-(4-phenoxyphenoxy)-3-pyridinyl]phenyl]methyl]acetamide (PubChem CID 129142524) has the molecular formula C26H22N2O3 and a molecular weight of 410.47 g/mol. Its IUPAC name is N-[[3-[4-(4-phenoxyphenoxy)-3-pyridinyl]phenyl]methyl]acetamide.
| Compound Name | N-[[3-[4-(4-phenoxyphenoxy)-3-pyridinyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 129142524 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | N-[[3-[4-(4-phenoxyphenoxy)-3-pyridinyl]phenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1cccc(-c2cnccc2Oc2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C26H22N2O3/c1-19(29)28-17-20-6-5-7-21(16-20)25-18-27-15-14-26(25)31-24-12-10-23(11-13-24)30-22-8-3-2-4-9-22/h2-16,18H,17H2,1H3,(H,28,29) |
| InChIKey | FUBDDRBYPFAEJX-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |