C27H23N3O3 — CID 129142730
N-[[3-[2-amino-4-(4-phenoxyphenoxy)-3-pyridinyl]phenyl]methyl]prop-2-enamide (PubChem CID 129142730) has the molecular formula C27H23N3O3 and a molecular weight of 437.50 g/mol. Its IUPAC name is N-[[3-[2-amino-4-(4-phenoxyphenoxy)-3-pyridinyl]phenyl]methyl]prop-2-enamide.
| Compound Name | N-[[3-[2-amino-4-(4-phenoxyphenoxy)-3-pyridinyl]phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 129142730 |
| Molecular Formula | C27H23N3O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | N-[[3-[2-amino-4-(4-phenoxyphenoxy)-3-pyridinyl]phenyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1cccc(-c2c(Oc3ccc(Oc4ccccc4)cc3)ccnc2N)c1 |
| InChI | InChI=1S/C27H23N3O3/c1-2-25(31)30-18-19-7-6-8-20(17-19)26-24(15-16-29-27(26)28)33-23-13-11-22(12-14-23)32-21-9-4-3-5-10-21/h2-17H,1,18H2,(H2,28,29)(H,30,31) |
| InChIKey | OHZCJOIGAHKYJP-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|