C12H12N4O — CID 139018828
N-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]prop-2-enamide (PubChem CID 139018828) has the molecular formula C12H12N4O and a molecular weight of 228.25 g/mol. Its IUPAC name is N-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]prop-2-enamide.
| Compound Name | N-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 139018828 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | N-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1cccc(-c2ncn[nH]2)c1 |
| InChI | InChI=1S/C12H12N4O/c1-2-11(17)13-7-9-4-3-5-10(6-9)12-14-8-15-16-12/h2-6,8H,1,7H2,(H,13,17)(H,14,15,16) |
| InChIKey | AUCVUBCVBGCFSQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|