C18H23N5O2 — CID 86793317
1-(2-cyclopropyloxan-4-yl)-3-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]urea (PubChem CID 86793317) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is 1-(2-cyclopropyloxan-4-yl)-3-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]urea.
| Compound Name | 1-(2-cyclopropyloxan-4-yl)-3-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 86793317 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 1-(2-cyclopropyloxan-4-yl)-3-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]urea |
| SMILES | O=C(NCc1cccc(-c2ncn[nH]2)c1)NC1CCOC(C2CC2)C1 |
| InChI | InChI=1S/C18H23N5O2/c24-18(22-15-6-7-25-16(9-15)13-4-5-13)19-10-12-2-1-3-14(8-12)17-20-11-21-23-17/h1-3,8,11,13,15-16H,4-7,9-10H2,(H2,19,22,24)(H,20,21,23) |
| InChIKey | LLDCZUJFXMBWTB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |