C24H20N4O3 — CID 71092919
3-[[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]methyl]benzoic acid (PubChem CID 71092919) has the molecular formula C24H20N4O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is 3-[[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]methyl]benzoic acid.
| Compound Name | 3-[[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 71092919 |
| Molecular Formula | C24H20N4O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 3-[[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]methyl]benzoic acid |
| SMILES | Nc1ncnc(NCc2cccc(C(=O)O)c2)c1-c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C24H20N4O3/c25-22-21(17-9-11-20(12-10-17)31-19-7-2-1-3-8-19)23(28-15-27-22)26-14-16-5-4-6-18(13-16)24(29)30/h1-13,15H,14H2,(H,29,30)(H3,25,26,27,28) |
| InChIKey | DCSJEVYMWXRUOB-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |