C23H24N4O3 — CID 71093028
3-[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]cyclohexane-1-carboxylic acid (PubChem CID 71093028) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is 3-[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 3-[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 71093028 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 3-[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]cyclohexane-1-carboxylic acid |
| SMILES | Nc1ncnc(NC2CCCC(C(=O)O)C2)c1-c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C23H24N4O3/c24-21-20(15-9-11-19(12-10-15)30-18-7-2-1-3-8-18)22(26-14-25-21)27-17-6-4-5-16(13-17)23(28)29/h1-3,7-12,14,16-17H,4-6,13H2,(H,28,29)(H3,24,25,26,27) |
| InChIKey | XMVFBEORPJUCGO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |