C25H29N5O3 — CID 71092765
trans-(1S,3S)-3-[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]-N-(methoxymethyl)cyclohexane-1-carboxamide (PubChem CID 71092765) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is trans-(1S,3S)-3-[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]-N-(methoxymethyl)cyclohexane-1-carboxamide.
| Compound Name | trans-(1S,3S)-3-[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]-N-(methoxymethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 71092765 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | trans-(1S,3S)-3-[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]-N-(methoxymethyl)cyclohexane-1-carboxamide |
| SMILES | COCNC(=O)[C@H]1CCC[C@H](Nc2ncnc(N)c2-c2ccc(Oc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C25H29N5O3/c1-32-16-29-25(31)18-6-5-7-19(14-18)30-24-22(23(26)27-15-28-24)17-10-12-21(13-11-17)33-20-8-3-2-4-9-20/h2-4,8-13,15,18-19H,5-7,14,16H2,1H3,(H,29,31)(H3,26,27,28,30)/t18-,19-/m0/s1 |
| InChIKey | XPKOCMLMLHDITR-OALUTQOASA-N |
| XLogP | 4.21 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|