C24H26N4O3 — CID 71092984
methyl (3S)-3-[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]cyclohexane-1-carboxylate (PubChem CID 71092984) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is methyl (3S)-3-[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]cyclohexane-1-carboxylate.
| Compound Name | methyl (3S)-3-[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 71092984 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | methyl (3S)-3-[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC[C@H](Nc2ncnc(N)c2-c2ccc(Oc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C24H26N4O3/c1-30-24(29)17-6-5-7-18(14-17)28-23-21(22(25)26-15-27-23)16-10-12-20(13-11-16)31-19-8-3-2-4-9-19/h2-4,8-13,15,17-18H,5-7,14H2,1H3,(H3,25,26,27,28)/t17?,18-/m0/s1 |
| InChIKey | GDINDCLUVSGNLF-ZVAWYAOSSA-N |
| XLogP | 4.66 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |