C21H23N5O — CID 71092816
5-(4-phenoxyphenyl)-4-N-piperidin-4-ylpyrimidine-4,6-diamine (PubChem CID 71092816) has the molecular formula C21H23N5O and a molecular weight of 361.45 g/mol. Its IUPAC name is 5-(4-phenoxyphenyl)-4-N-piperidin-4-ylpyrimidine-4,6-diamine.
| Compound Name | 5-(4-phenoxyphenyl)-4-N-piperidin-4-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 71092816 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 5-(4-phenoxyphenyl)-4-N-piperidin-4-ylpyrimidine-4,6-diamine |
| SMILES | Nc1ncnc(NC2CCNCC2)c1-c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C21H23N5O/c22-20-19(21(25-14-24-20)26-16-10-12-23-13-11-16)15-6-8-18(9-7-15)27-17-4-2-1-3-5-17/h1-9,14,16,23H,10-13H2,(H3,22,24,25,26) |
| InChIKey | REMQUQSIHHWNNP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |