C27H29N5O2 — CID 89266684
1-[8-[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]-5-azaspiro[3.5]nonan-3-yl]prop-2-en-1-one (PubChem CID 89266684) has the molecular formula C27H29N5O2 and a molecular weight of 455.56 g/mol. Its IUPAC name is 1-[8-[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]-5-azaspiro[3.5]nonan-3-yl]prop-2-en-1-one.
| Compound Name | 1-[8-[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]-5-azaspiro[3.5]nonan-3-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 89266684 |
| Molecular Formula | C27H29N5O2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 1-[8-[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]-5-azaspiro[3.5]nonan-3-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)C1CCC12CC(Nc1ncnc(N)c1-c1ccc(Oc3ccccc3)cc1)CCN2 |
| InChI | InChI=1S/C27H29N5O2/c1-2-23(33)22-12-14-27(22)16-19(13-15-31-27)32-26-24(25(28)29-17-30-26)18-8-10-21(11-9-18)34-20-6-4-3-5-7-20/h2-11,17,19,22,31H,1,12-16H2,(H3,28,29,30,32) |
| InChIKey | ZORXVIWFTVXXKZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|