C26H27N5O2 — CID 86721805
N-[6-[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]spiro[3.3]heptan-2-yl]prop-2-enamide (PubChem CID 86721805) has the molecular formula C26H27N5O2 and a molecular weight of 441.54 g/mol. Its IUPAC name is N-[6-[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]spiro[3.3]heptan-2-yl]prop-2-enamide.
| Compound Name | N-[6-[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]spiro[3.3]heptan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 86721805 |
| Molecular Formula | C26H27N5O2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | N-[6-[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]spiro[3.3]heptan-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CC2(C1)CC(Nc1ncnc(N)c1-c1ccc(Oc3ccccc3)cc1)C2 |
| InChI | InChI=1S/C26H27N5O2/c1-2-22(32)30-18-12-26(13-18)14-19(15-26)31-25-23(24(27)28-16-29-25)17-8-10-21(11-9-17)33-20-6-4-3-5-7-20/h2-11,16,18-19H,1,12-15H2,(H,30,32)(H3,27,28,29,31) |
| InChIKey | MNRLAIAWOKCYRR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|