C24H26ClN5O2 — CID 167032805
4-N-[2-(2-chloroethoxy)-2-azaspiro[3.3]heptan-6-yl]-5-(4-phenoxyphenyl)pyrimidine-4,6-diamine (PubChem CID 167032805) has the molecular formula C24H26ClN5O2 and a molecular weight of 451.96 g/mol. Its IUPAC name is 4-N-[2-(2-chloroethoxy)-2-azaspiro[3.3]heptan-6-yl]-5-(4-phenoxyphenyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-[2-(2-chloroethoxy)-2-azaspiro[3.3]heptan-6-yl]-5-(4-phenoxyphenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 167032805 |
| Molecular Formula | C24H26ClN5O2 |
| Molecular Weight | 451.96 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | 4-N-[2-(2-chloroethoxy)-2-azaspiro[3.3]heptan-6-yl]-5-(4-phenoxyphenyl)pyrimidine-4,6-diamine |
| SMILES | Nc1ncnc(NC2CC3(C2)CN(OCCCl)C3)c1-c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C24H26ClN5O2/c25-10-11-31-30-14-24(15-30)12-18(13-24)29-23-21(22(26)27-16-28-23)17-6-8-20(9-7-17)32-19-4-2-1-3-5-19/h1-9,16,18H,10-15H2,(H3,26,27,28,29) |
| InChIKey | FUWOIEZRMNMHFT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.96 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|