C24H27N5O2 — CID 167032699
N-[3-[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]propyl]-N-ethylprop-2-enamide (PubChem CID 167032699) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is N-[3-[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]propyl]-N-ethylprop-2-enamide.
| Compound Name | N-[3-[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]propyl]-N-ethylprop-2-enamide |
|---|---|
| PubChem CID | 167032699 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | N-[3-[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]propyl]-N-ethylprop-2-enamide |
| SMILES | C=CC(=O)N(CC)CCCNc1ncnc(N)c1-c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C24H27N5O2/c1-3-21(30)29(4-2)16-8-15-26-24-22(23(25)27-17-28-24)18-11-13-20(14-12-18)31-19-9-6-5-7-10-19/h3,5-7,9-14,17H,1,4,8,15-16H2,2H3,(H3,25,26,27,28) |
| InChIKey | SXCRNCGEMRGKFC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|