C24H24N6O2 — CID 90225748
N-[4-[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]butyl]-2-cyanoprop-2-enamide (PubChem CID 90225748) has the molecular formula C24H24N6O2 and a molecular weight of 428.50 g/mol. Its IUPAC name is N-[4-[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]butyl]-2-cyanoprop-2-enamide.
| Compound Name | N-[4-[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]butyl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 90225748 |
| Molecular Formula | C24H24N6O2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | N-[4-[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]butyl]-2-cyanoprop-2-enamide |
| SMILES | C=C(C#N)C(=O)NCCCCNc1ncnc(N)c1-c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C24H24N6O2/c1-17(15-25)24(31)28-14-6-5-13-27-23-21(22(26)29-16-30-23)18-9-11-20(12-10-18)32-19-7-3-2-4-8-19/h2-4,7-12,16H,1,5-6,13-14H2,(H,28,31)(H3,26,27,29,30) |
| InChIKey | KUFSHDANHZEFIU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|