C26H26N6O3 — CID 90225977
2-[4-[[[6-amino-5-[4-(4-hydroxyphenoxy)phenyl]pyrimidin-4-yl]amino]methyl]piperidine-1-carbonyl]prop-2-enenitrile (PubChem CID 90225977) has the molecular formula C26H26N6O3 and a molecular weight of 470.53 g/mol. Its IUPAC name is 2-[4-[[[6-amino-5-[4-(4-hydroxyphenoxy)phenyl]pyrimidin-4-yl]amino]methyl]piperidine-1-carbonyl]prop-2-enenitrile.
| Compound Name | 2-[4-[[[6-amino-5-[4-(4-hydroxyphenoxy)phenyl]pyrimidin-4-yl]amino]methyl]piperidine-1-carbonyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 90225977 |
| Molecular Formula | C26H26N6O3 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 2-[4-[[[6-amino-5-[4-(4-hydroxyphenoxy)phenyl]pyrimidin-4-yl]amino]methyl]piperidine-1-carbonyl]prop-2-enenitrile |
| SMILES | C=C(C#N)C(=O)N1CCC(CNc2ncnc(N)c2-c2ccc(Oc3ccc(O)cc3)cc2)CC1 |
| InChI | InChI=1S/C26H26N6O3/c1-17(14-27)26(34)32-12-10-18(11-13-32)15-29-25-23(24(28)30-16-31-25)19-2-6-21(7-3-19)35-22-8-4-20(33)5-9-22/h2-9,16,18,33H,1,10-13,15H2,(H3,28,29,30,31) |
| InChIKey | KSUQOPDHVNCDSC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 137.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|