C26H33N7O2 — CID 90225769
2-[4-[[[6-amino-5-[4-(1-methylpiperidin-4-yl)oxyphenyl]pyrimidin-4-yl]amino]methyl]piperidine-1-carbonyl]prop-2-enenitrile (PubChem CID 90225769) has the molecular formula C26H33N7O2 and a molecular weight of 475.60 g/mol. Its IUPAC name is 2-[4-[[[6-amino-5-[4-(1-methylpiperidin-4-yl)oxyphenyl]pyrimidin-4-yl]amino]methyl]piperidine-1-carbonyl]prop-2-enenitrile.
| Compound Name | 2-[4-[[[6-amino-5-[4-(1-methylpiperidin-4-yl)oxyphenyl]pyrimidin-4-yl]amino]methyl]piperidine-1-carbonyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 90225769 |
| Molecular Formula | C26H33N7O2 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | 2-[4-[[[6-amino-5-[4-(1-methylpiperidin-4-yl)oxyphenyl]pyrimidin-4-yl]amino]methyl]piperidine-1-carbonyl]prop-2-enenitrile |
| SMILES | C=C(C#N)C(=O)N1CCC(CNc2ncnc(N)c2-c2ccc(OC3CCN(C)CC3)cc2)CC1 |
| InChI | InChI=1S/C26H33N7O2/c1-18(15-27)26(34)33-13-7-19(8-14-33)16-29-25-23(24(28)30-17-31-25)20-3-5-21(6-4-20)35-22-9-11-32(2)12-10-22/h3-6,17,19,22H,1,7-14,16H2,2H3,(H3,28,29,30,31) |
| InChIKey | GNQAQHVWNKFEEO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 120.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|