C28H34N6O2 — CID 71092806
1-[4-[[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]methyl]piperidin-1-yl]-4-(dimethylamino)but-2-en-1-one (PubChem CID 71092806) has the molecular formula C28H34N6O2 and a molecular weight of 486.62 g/mol. Its IUPAC name is 1-[4-[[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]methyl]piperidin-1-yl]-4-(dimethylamino)but-2-en-1-one.
| Compound Name | 1-[4-[[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]methyl]piperidin-1-yl]-4-(dimethylamino)but-2-en-1-one |
|---|---|
| PubChem CID | 71092806 |
| Molecular Formula | C28H34N6O2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | 1-[4-[[[6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl]amino]methyl]piperidin-1-yl]-4-(dimethylamino)but-2-en-1-one |
| SMILES | CN(C)CC=CC(=O)N1CCC(CNc2ncnc(N)c2-c2ccc(Oc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C28H34N6O2/c1-33(2)16-6-9-25(35)34-17-14-21(15-18-34)19-30-28-26(27(29)31-20-32-28)22-10-12-24(13-11-22)36-23-7-4-3-5-8-23/h3-13,20-21H,14-19H2,1-2H3,(H3,29,30,31,32) |
| InChIKey | GSNXLMAAVFCELU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|